Ascorbic Acid
Request a quote| Catalog Number | ACM50817-3 |
| CAS | 50-81-7 |
| Structure | ![{[CurrentData.Name]}](https://resource.alfa-chemistry.com/structure/50-81-7.gif) |
| Description | Ascorbic acid is a naturally occurring organic compound and a form of Vitamin C. It is water-soluble and found in high concentrations in many types of fruits and vegetables, especially citrus fruits such as oranges and lemons. It is used in some beauty and skincare products due to its antioxidant properties. |
| IUPAC Name | (2R)-2-[(1S)-1,2-Dihydroxyethyl]-3,4-dihydroxy-2H-furan-5-one |
| Synonyms | Ascoltin |
| Molecular Weight | 176.12 |
| Molecular Formula | C6H8O6 |
| Canonical SMILES | C(C(C1C(=C(C(=O)O1)O)O)O)O |
| Inchi | InChI=1S/C6H8O6/c7-1-2(8)5-3(9)4(10)6(11)12-5/h2,5,7-10H,1H2/t2-,5+/m0/s1 |
| InChIKey | CIWBSHSKHKDKBQ-JLAZNSOCSA-N |
| Boiling Point | 227.71 °C |
| Melting Point | 190-194 °C |
| Flash Point | 180.4 °C |
| Purity | 99% |
| Density | 1.65 g/cm³ |
| Solubility | Insoluble in ether, chloroform, benzene, petroleum ether, oils, fats, fat solvents |
| Appearance | Solid |
| Storage | 5-30 °C |
Ask Your Question
