Artemisitene
Request a quote| Catalog Number | ACM101020897 |
| CAS | 101020-89-7 |
| Structure | ![{[CurrentData.Name]}](https://resource.alfa-chemistry.com/structure/101020-89-7.gif) |
| Description | Artemisitene, a natural derivative of Artemisinin, is a Nrf2 activator with antioxidant and anticancer activities. Artemisitene activates Nrf2 by decreasing Nrf2 ubiquitination and increasing its stability. |
| Molecular Weight | 280.32 |
| Molecular Formula | C15H20O5 |
| Canonical SMILES | C=C1[C@@](CC[C@H]2C)([H])[C@@]([C@@]2([H])CC3)(OO4)[C@@](OC1=O)([H])O[C@@]34C |
| Purity | 98.74% |
| Appearance | Solid |
| Storage | Powder-20°C, 3 years; 4°C, 2 years; In solvent-80°C, 6 months; -20°C, 1 month. |
Ask Your Question
