2-Aminoterephthalic acid
Request a quote| Catalog Number | ACM10312557-1 |
| Product Name | 2-Aminoterephthalic acid |
| CAS Number | 10312-55-7 |
| Structure |  |
| IUPAC Name | 2-aminoterephthalic acid |
| Synonyms | Dimethyl 5-bromo terephthalate |
| Molecular Weight | 181.14 |
| Molecular Formula | C8H7NO4 |
| Canonical SMILES | C1=CC(=C(C=C1C(=O)O)N)C(=O)O |
| Inchi | InChI=1S/C8H7NO4/c9-6-3-4(7(10)11)1-2-5(6)8(12)13/h1-3H,9H2,(H,10,11)(H,12,13) |
| InChIKey | GPNNOCMCNFXRAO-UHFFFAOYSA-N |
| Melting Point | 248 °C |
| Purity | 97% |
| Appearance | Light yellow to Amber to Dark green powder to crystal |
| Storage | Store under inert gas |
| Physical State | Yellow solid |
| Refractive Index | 1.62 |
Ask Your Question
