Acetophenone
Request a quote| Catalog Number | ACM98862 |
| Product Name | Acetophenone |
| CAS Number | 98-86-2 |
| Structure |  |
| Description | Acetophenone is the organic compound with the formula C6H5C(O)CH3 (also represented by the letters PhAc or BzMe), is the simplest aromatic ketone. This colourless, viscous liquid is a precursor to useful resins and fragrances. |
| IUPAC Name | 1-Phenylethanone |
| Synonyms | Acetyl-benzen |
| Molecular Weight | 120.15 |
| Molecular Formula | C8H8O |
| Canonical SMILES | CC(=O)C1=CC=CC=C1 |
| Inchi | InChI=1S/C8H8O/c1-7(9)8-5-3-2-4-6-8/h2-6H,1H3 |
| InChIKey | KWOLFJPFCHCOCG-UHFFFAOYSA-N |
| Boiling Point | 202 °C(lit.) |
| Melting Point | 19-20 °C(lit.) |
| Flash Point | 180 °F |
| Purity | 99%+ |
| Density | 1.03 g/mL at 25 °C(lit.) |
| Solubility | Slightly soluble in water |
| Appearance | Clear colorless to light yellow liquid |
| Storage | Store below +30 °C |
| Physical State | Liquid |
| Refractive Index | n20/D 1.534(lit.) |
Ask Your Question
