5-Methoxyisophthalic Acid
Request a quote| Catalog Number | ACM46331504 |
| Product Name | 5-Methoxyisophthalic Acid |
| CAS Number | 46331-50-4 |
| Structure |  |
| IUPAC Name | 5-methoxybenzene-1,3-dicarboxylic acid |
| Molecular Weight | 196.16 |
| Molecular Formula | C9H8O5 |
| Canonical SMILES | COC1=CC(=CC(=C1)C(=O)O)C(=O)O |
| Inchi | InChI=1S/C9H8O5/c1-14-7-3-5(8(10)11)2-6(4-7)9(12)13/h2-4H,1H3,(H,10,11)(H,12,13) |
| InChIKey | POSMIIJADZKUPL-UHFFFAOYSA-N |
| Boiling Point | 440.8 °C at 760 mmHg |
| Melting Point | 270 °C |
| Purity | 97% |
| Appearance | White to Almost white powder to crystal |
| Storage | Store under inert gas |
Ask Your Question
