4-Hydroxycoumarin
Request a quote| Catalog Number | ACM1076386 |
| Product Name | 4-Hydroxycoumarin |
| CAS Number | 1076-38-6 |
| Structure |  |
| Description | 4-Hydroxycoumarin, a coumarin derivative, is one of the most versatile heterocyclic scaffolds and is frequently applied in the synthesis of various organic compounds. 4-Hydroxycoumarin possesses both electrophilic and nucleophilic properties. 4-Hydroxycoumarin derivatives are employed as the anticoagulant, antibacterial, antifungal, antiviral, antitumor, antiprotozoal, insecticidal, antimycobacterial, antimutagenic, antioxidant, anti-inflammatory agents, HIV protease inhibitors and tyrosine kinase inhibitors. |
| IUPAC Name | 4-Hydroxychromen-2-one |
| Synonyms | Coumarinol |
| Molecular Weight | 162.14 |
| Molecular Formula | C9H6O3 |
| Canonical SMILES | C1=CC=C2C(=C1)C(=CC(=O)O2)O |
| Inchi | InChI=1S/C9H6O3/c10-7-5-9(11)12-8-4-2-1-3-6(7)8/h1-5,10H |
| InChIKey | VXIXUWQIVKSKSA-UHFFFAOYSA-N |
| Boiling Point | 228.82 °C |
| Melting Point | 211-213 °C(lit.) |
| Flash Point | 165.35 °C |
| Purity | 98% |
| Density | 1.1734 g/cm³ |
| Solubility | Practically insoluble in water |
| Appearance | Beige powder |
| Storage | Store below +30 °C |
| Physical State | Liquid |
| Refractive Index | 1.4500 |
Ask Your Question
