4-Ethynylbenzoic Acid
Request a quote| Catalog Number | ACM10602003 |
| Product Name | 4-Ethynylbenzoic Acid |
| CAS Number | 10602-00-3 |
| Structure |  |
| IUPAC Name | 4-ethynylbenzoic acid |
| Molecular Weight | 146.14 |
| Molecular Formula | C9H6O2 |
| Canonical SMILES | C#CC1=CC=C(C=C1)C(=O)O |
| Inchi | InChI=1S/C9H6O2/c1-2-7-3-5-8(6-4-7)9(10)11/h1,3-6H,(H,10,11) |
| InChIKey | SJXHLZCPDZPBPW-UHFFFAOYSA-N |
| Melting Point | 192 °C |
| Purity | 98% |
| Density | Air Sensitive |
| Appearance | Light yellow to Amber to Dark green powder to crystal |
| Storage | Store under inert gas |
Ask Your Question
