4-Ethoxybenzaldehyde
Request a quote| Catalog Number | ACM10031820 |
| Product Name | 4-Ethoxybenzaldehyde |
| CAS Number | 10031-82-0 |
| Structure |  |
| Description | Liquid;Liquid;colourless liquid with a sweet, floral, anise odour |
| IUPAC Name | 4-ethoxybenzaldehyde |
| Synonyms | P-Ethoxybenzaldehyde |
| Molecular Weight | 150.17 |
| Molecular Formula | C9H10O2 |
| Canonical SMILES | CCOC1=CC=C(C=O)C=C1 |
| Inchi | InChI=1S/C9H10O2/c1-2-11-9-5-3-8(7-10)4-6-9/h3-7H,2H2,1H3 |
| InChIKey | JRHHJNMASOIRDS-UHFFFAOYSA-N |
| Boiling Point | 255 °C |
| Melting Point | 13-14°C |
| Flash Point | 75°C |
| Purity | 98% |
| Density | 1.08 |
| Solubility | poorly soluble in water, glycols, glycerol; soluble in organic solvents, oils;miscible at room temperature (in ethanol) |
| Appearance | Yellow to light brown clear liquid |
| Storage | Store under inert gas |
| Physical State | Liquid |
| Refractive Index | 1.5574-1.5594 |
Ask Your Question
