4,4'-Dihydroxybiphenyl
Request a quote| Catalog Number | ACM92886-4 |
| Product Name | 4,4'-Dihydroxybiphenyl |
| CAS Number | 92-88-6 |
| Structure |  |
| Description | DryPowder |
| IUPAC Name | 4-(4-hydroxyphenyl)phenol |
| Synonyms | 4,4'-Biphenol, 4,4'-Biphenyldiol, 4,4'-Diphenol |
| Molecular Weight | 186.21 |
| Molecular Formula | C12H10O2 |
| Canonical SMILES | C1=CC(=CC=C1C2=CC=C(C=C2)O)O |
| Inchi | InChI=1S/C12H10O2/c13-11-5-1-9(2-6-11)10-3-7-12(14)8-4-10/h1-8,13-14H |
| InChIKey | VCCBEIPGXKNHFW-UHFFFAOYSA-N |
| Boiling Point | 355.2 °C at 760 mmHg (Predicted) |
| Melting Point | 280-282 ºC |
| Purity | 98% |
| Density | 1.22 g/ml |
| Appearance | Powder |
| Application | Used in the preparation of polyether liquid crystals. |
| Refractive Index | 1.64 (Predicted) |
Ask Your Question
