1,3,6,8-Tetraphenylpyrene
Request a quote| Catalog Number | ACM13638829-1 |
| Product Name | 1,3,6,8-Tetraphenylpyrene |
| CAS Number | 13638-82-9 |
| Structure |  |
| IUPAC Name | 1,3,6,8-tetraphenylpyrene |
| Synonyms | 1,3,6,8-TETRAPHENYLPYRENE |
| Molecular Weight | 506.63 |
| Molecular Formula | C40H26 |
| Canonical SMILES | C1=CC=C(C=C1)C2=CC(=C3C=CC4=C(C=C(C5=C4C3=C2C=C5)C6=CC=CC=C6)C7=CC=CC=C7)C8=CC=CC=C8 |
| Inchi | InChI=1S/C40H26/c1-5-13-27(14-6-1)35-25-36(28-15-7-2-8-16-28)32-23-24-34-38(30-19-11-4-12-20-30)26-37(29-17-9-3-10-18-29)33-22-21-31(35)39(32)40(33)34/h1-26H |
| InChIKey | SIJHJHYRYHIWFW-UHFFFAOYSA-N |
| Boiling Point | 659.2 °C at 760 mmHg |
| Melting Point | 299 °C |
| Purity | 97% |
| Appearance | Light orange to yellow to green powder to crystal |
| Storage | Store under inert gas |
Ask Your Question
