Usnic Acid
Request a quote| Catalog Number | ACM125462 |
| CAS | 125-46-2 |
| Structure | ![{[CurrentData.Name]}](https://resource.alfa-chemistry.com/structure/125-46-2.gif) |
| Description | Usnic acid, a lichen-derived secondary metabolite, has a unique dibenzofuran skeleton. Usnic acid has excellent anticancer and antimicrobial properties. Usnic acid significantly inhibits RANKL-mediated osteoclast formation and function by reducing the transcriptional and translational expression of NFATc1. |
| Synonyms | 1,3(2H,9bH)-Dibenzofurandione, 2,6-diacetyl-7,9-dihydroxy-8,9b-dimethyl- |
| Molecular Weight | 344.32 |
| Molecular Formula | C18H16O7 |
| Canonical SMILES | O=C(C1(C)C(OC2=C(C(C)=O)C(O)=C(C)C(O)=C12)=C3)C(C(C)=O)C3=O |
| Melting Point | 201-203°C |
| Flash Point | 223.3°C |
| Purity | 98% |
| Density | 1.54 g/cm³ |
| Appearance | Solid |
| Storage | Powder-20°C, 3 years; 4°C, 2 years; In solvent-80°C, 6 months; -20°C, 1 month. |
| Physical State | Solid |
| Refractive Index | 1.678 |
Ask Your Question
