Trans-Chalcone
Request a quote| Catalog Number | ACM614471 |
| CAS | 614-47-1 |
| Structure | ![{[CurrentData.Name]}](https://resource.alfa-chemistry.com/structure/614-47-1.gif) |
| Description | trans-Chalcone, isolated from Aronia melanocarpa skin, is a biphenolic core structure of flavonoids precursor. trans-Chalcone is a potent fatty acid synthase (FAS) and α-amylase inhibitor. trans-Chalcone causes cellcycle arrest and induces apoptosis in the breastcancer cell line MCF-7. trans-Chalcone has antifungal and anticancer activity. |
| IUPAC Name | (E)-1,3-Diphenylprop-2-en-1-one |
| Synonyms | Phenyltrans-styrylketone |
| Molecular Weight | 208.26 |
| Molecular Formula | C15H12O |
| Canonical SMILES | C1=CC=C(C=C1)C=CC(=O)C2=CC=CC=C2 |
| Inchi | InChI=1S/C15H12O/c16-15(14-9-5-2-6-10-14)12-11-13-7-3-1-4-8-13/h1-12H/b12-11+ |
| InChIKey | DQFBYFPFKXHELB-VAWYXSNFSA-N |
| Boiling Point | 208 °C/25 mmHg(lit.) |
| Melting Point | 55-59 °C |
| Flash Point | >230 °F |
| Purity | 95% |
| Density | 1.0712 g/cm³ |
| Appearance | Pale yellow solid |
| Storage | Sealed in dry, room temperature |
| Refractive Index | 1.5361 |
Ask Your Question
