5,7,3',4'-Tetramethoxyflavone
Request a quote| Catalog Number | ACM855970-1 |
| CAS | 855-97-0 |
| Structure | ![{[CurrentData.Name]}](https://resource.alfa-chemistry.com/structure/855-97-0.gif) |
| Description | 5,7,3',4'-Tetramethoxyflavone, one of the major polymethoxyflavones (PMFs) isolated from M. exotica, possesses various bioactivities, including anti-fungal, anti-malarial, anti-mycobacterial, and anti-inflammatory activities. 5,7,3',4'-Tetramethoxyflavone exhibits chondroprotective activity by targeting β-catenin signaling. |
| IUPAC Name | 2-(3,4-dimethoxyphenyl)-5,7-dimethoxychromen-4-one |
| Molecular Weight | 342.3 |
| Molecular Formula | C19H18O6 |
| Canonical SMILES | COC1=C(C=C(C=C1)C2=CC(=O)C3=C(O2)C=C(C=C3OC)OC)OC |
| Inchi | InChI=1S/C19H18O6/c1-21-12-8-17(24-4)19-13(20)10-15(25-18(19)9-12)11-5-6-14(22-2)16(7-11)23-3/h5-10H,1-4H3 |
| InChIKey | CLXVBVLQKLQNRQ-UHFFFAOYSA-N |
| Purity | 98% |
| Appearance | Powder |
Ask Your Question
