Tetrahydrofurfuryl acetate
Request a quote| Catalog Number | ACM637649 |
| CAS | 637-64-9 |
| Structure | ![{[CurrentData.Name]}](https://resource.alfa-chemistry.com/structure/637-64-9.gif) |
| Description | Soluble in water, alcohol, ether, and chloroform. Combustible.Tetrahydrofurfuryl acetate has a faint, fruity, ethereal odor, somewhat similar to acetic acid (reminiscent of methyl formate). It has a sweet, ethereal, deep, fruit-like flavor |
| IUPAC Name | Oxolan-2-ylmethyl acetate |
| Synonyms | 2-Acetoxymethyloxolane |
| Molecular Weight | 144.17 |
| Molecular Formula | C7H12O3 |
| Canonical SMILES | CC(=O)OCC1CCCO1 |
| Inchi | InChI=1S/C7H12O3/c1-6(8)10-5-7-3-2-4-9-7/h7H,2-5H2,1H3 |
| InChIKey | AAQDYYFAFXGBFZ-UHFFFAOYSA-N |
| Boiling Point | 194-195 °C |
| Flash Point | 184 °F |
| Purity | 95%+ |
| Density | 1.061 g/mL at 25 °C(lit.) |
| Solubility | Soluble in water, ether, chloroform |
| Appearance | Colorless clear liquid (est) |
| Physical State | Liquid |
| Refractive Index | n20/D 1.437(lit.) |
Ask Your Question
