Pyruvic Acid
Request a quote| Catalog Number | ACM127173 |
| CAS | 127-17-3 |
| Structure | ![{[CurrentData.Name]}](https://resource.alfa-chemistry.com/structure/127-17-3.gif) |
| Description | Pyruvic acid (CH3COCOOH) is the simplest of the alpha-keto acids, with a carboxylic acid and a ketone functional group. Pyruvate, the conjugate base, CH3COCOO−, is an intermediate in several metabolic pathways throughout the cell.; |
| IUPAC Name | 2-Oxopropanoic acid |
| Synonyms | α-Ketopropionic acid |
| Molecular Weight | 88.06 |
| Molecular Formula | C3H4O3 |
| Canonical SMILES | CC(=O)C(=O)O |
| Inchi | InChI=1S/C3H4O3/c1-2(4)3(5)6/h1H3,(H,5,6) |
| InChIKey | LCTONWCANYUPML-UHFFFAOYSA-N |
| Boiling Point | 165 °C(lit.) |
| Melting Point | 11-12 °C(lit.) |
| Flash Point | 183 °F |
| Purity | 99% |
| Density | 1.267 g/mL at 25 °C(lit.) |
| Solubility | Miscible with chloroform and methanol |
| Appearance | Liquid |
| Storage | 2-8 °C |
| Physical State | Liquid |
| Refractive Index | n20/D 1.428(lit.) |
Ask Your Question
