Oenothein B
Request a quote| Catalog Number | ACM104987362 |
| CAS | 104987-36-2 |
| Structure | ![{[CurrentData.Name]}](https://resource.alfa-chemistry.com/structure/104987-36-2.gif) |
| Description | Oenothein B is a dimeric macrocyclic ellagitannin and has widely pharmacological activities, including antioxidant, anti-inflammatory, antifungal, anti-HCV, and antitumor properties. Oenothein B is a potent and specific inhibitor of poly(ADP-ribose) glycohydrolase. |
| Molecular Weight | 1571.10 |
| Molecular Formula | C68H50O44 |
| Canonical SMILES | O[C@@H]1O[C@@H]2COC(C3=C(C4=C(C(O[C@H]2[C@@H]([C@H]1OC(C5=CC(O)=C(C(O)=C5OC6=CC(C(OC[C@H]7O[C@H]([C@@H]([C@@H]([C@H]7O8)OC(C9=CC(O)=C(C(O)=C9)O)=O)O)OC(C%10=CC(O)=C(C(O)=C%10)O)=O)=O)=C(C(O)=C6O)C%11=C(C=C(C(O)=C%11O)O)C8=O)O)=O)OC(C%12=CC(O)=C(O)C(O)=C%12)=O)=O)C=C(O)C(O)=C4O)C(O)=C(O)C(O)=C3)=O |
| Storage | Please store the product under the recommended conditions in the Certificate of Analysis. |
Ask Your Question
