Nimbolide
Request a quote| Catalog Number | ACM25990378 |
| CAS | 25990-37-8 |
| Structure | ![{[CurrentData.Name]}](https://resource.alfa-chemistry.com/structure/25990-37-8.gif) |
| Description | Nimbolide is a triterpene derived from the leaves and flowers of neem (Azadirachta indica). Nimbolide induces apoptosis through inactivation of NF-κB. Nimbolide inhibits CDK4/CDK6 kinase activity. Nimbolide suppresses the NF-κB, Wnt, PI3K-Akt, MAPK and JAK-STAT signaling pathways. |
| IUPAC Name | methyl 2-[6-(furan-3-yl)-7,9,11,15-tetramethyl-12,16-dioxo-3,17-dioxapentacyclo[9.6.1.02,9.04,8.015,18]octadeca-7,13-dien-10-yl]acetate |
| Molecular Weight | 466.52 |
| Molecular Formula | C27H30O7 |
| Canonical SMILES | CC1=C2C(CC1C3=COC=C3)OC4C2(C(C5(C6C4OC(=O)C6(C=CC5=O)C)C)CC(=O)OC)C |
| Inchi | InChI=1S/C27H30O7/c1-13-15(14-7-9-32-12-14)10-16-20(13)27(4)17(11-19(29)31-5)26(3)18(28)6-8-25(2)22(26)21(23(27)33-16)34-24(25)30/h6-9,12,15-17,21-23H,10-11H2,1-5H3 |
| InChIKey | JZIQWNPPBKFOPT-UHFFFAOYSA-N |
| Purity | 98% |
| Appearance | Powder |
Ask Your Question
