Neriifolin
Request a quote| Catalog Number | ACM466079 |
| CAS | 466-07-9 |
| Structure | ![{[CurrentData.Name]}](https://resource.alfa-chemistry.com/structure/466-07-9.gif) |
| Description | Neriifolin, a CNS-penetrating cardiac glycoside, is an inhibitor of the Na+, K+-ATPase. Neriifolin can target beclin 1, inhibits the formation of LC3-associated phagosomes and ameliorates experimental autoimmune encephalomyelitis (EAE) development. Neriifolin induces cell cycle arrest and apoptosis in human hepatocellular carcinoma HepG2 cells[2. |
| Molecular Weight | 534.68 |
| Molecular Formula | C30H46O8 |
| Canonical SMILES | O[C@@]12[C@@]3([H])[C@@](CC[C@@]1([C@](C4=CC(OC4)=O)([H])CC2)C)([H])[C@@]5([C@](C[C@H](CC5)O[C@H]6[C@H]([C@@H]([C@H]([C@@H](O6)C)O)OC)O)([H])CC3)C |
| Purity | 99% |
| Appearance | Solid |
| Storage | Powder-20°C, 3 years; In solvent-80°C. 6 months; -20°C, 1 month. |
Ask Your Question
