What is the CAS number of Neohesperidin?

The CAS number of Neohesperidin is 13241-33-3.

What is the molecular weight of Neohesperidin?

The molecular weight of Neohesperidin is 610.56.

What is the molecular formula of Neohesperidin?

The molecular formula of Neohesperidin is C28H34O15.

What is the purity of Neohesperidin?

The purity of Neohesperidin is 98%.

What are the synonyms for Neohesperidin?

The synonyms for Neohesperidin are 4H-1-Benzopyran-4-one, 2,3-dihydro-7-((2-O-(6-deoxy-alpha-L-mannopyranosyl)-beta-D-glucopyranosyl)oxy)-5-hydroxy-2-(3-hydroxy-4-methoxyphenyl)-, and (S)-.

What is the physical state of Neohesperidin?

The physical state of Neohesperidin is solid.

What are the typical applications of Neohesperidin?

Neohesperidin is typically used as an antioxidant.

What is the percentage of actives in Neohesperidin?

The percentage of actives in Neohesperidin is 95%.

What is the chemical structure of Neohesperidin?

The chemical structure of Neohesperidin is a 4H-1-Benzopyran-4-one with hydroxy and methoxy phenyl groups.

What is the source of Neohesperidin?

Neohesperidin is naturally found in citrus fruits and is extracted for various applications.

CAS 13241-33-3 Neohesperidin - Carboxyl / Alfa Chemistry

Name: Neohesperidin
SKU: ACM13241333
Rating: 5 (1 reviews)

Catalog Number	ACM13241333
CAS	13241-33-3
Structure
IUPAC Name	(2S)-7-[(2S,3R,4S,5S,6R)-4,5-Dihydroxy-6-(hydroxymethyl)-3-[(2S,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxyoxan-2-yl]oxy-5-hydroxy-2-(3-hydroxy-4-methoxyphenyl)-2,3-dihydrochromen-4-one
Synonyms	(2S)-Neohesperidin
Molecular Weight	610.56
Molecular Formula	C28H34O15
Canonical SMILES	CC1C(C(C(C(O1)OC2C(C(C(OC2OC3=CC(=C4C(=O)CC(OC4=C3)C5=CC(=C(C=C5)OC)O)O)CO)O)O)O)O)O
Inchi	InChI=1S/C28H34O15/c1-10-21(33)23(35)25(37)27(39-10)43-26-24(36)22(34)19(9-29)42-28(26)40-12-6-14(31)20-15(32)8-17(41-18(20)7-12)11-3-4-16(38-2)13(30)5-11/h3-7,10,17,19,21-31,33-37H,8-9H2,1-2H3/t10-,17-,19+,21-,22+,23+,24-,25+,26+,27-,28+/m0/s1
InChIKey	ARGKVCXINMKCAZ-UZRWAPQLSA-N
Boiling Point	933.7±65.0 °C
Melting Point	239-243 °C
Flash Point	306.7 °C
Purity	98%
Density	1.65±0.1 g/cm³
Storage	Sealed in dry, 2-8 °C
Physical State	Solid
Refractive Index	1.695