Methyl Mycophenolate
Request a quote| Catalog Number | ACM31858669 |
| CAS | 31858-66-9 |
| Structure | ![{[CurrentData.Name]}](https://resource.alfa-chemistry.com/structure/31858-66-9.gif) |
| Description | Methyl mycophenolate is found in the marine fungus Phaeosphaeria spartinae. Methyl mycophenolate is the methyl ester form of mycophenolic acid. |
| IUPAC Name | Methyl (E)-6-(4-hydroxy-6-methoxy-7-methyl-3-oxo-1H-2-benzofuran-5-yl)-4-methylhex-4-enoate |
| Synonyms | Mycophenolic acid methyl ester |
| Molecular Weight | 334.4 |
| Molecular Formula | C18H22O6 |
| Canonical SMILES | CC1=C2COC(=O)C2=C(C(=C1OC)CC=C(C)CCC(=O)OC)O |
| Inchi | InChI=1S/C18H22O6/c1-10(6-8-14(19)22-3)5-7-12-16(20)15-13(9-24-18(15)21)11(2)17(12)23-4/h5,20H,6-9H2,1-4H3/b10-5+ |
| InChIKey | ZPXRQFLATDNYSS-BJMVGYQFSA-N |
| Boiling Point | 540.4±50.0 °C (lit.) |
| Melting Point | 105-106 °C |
| Purity | 95%+ |
| Density | 1.222±0.06 g/cm³ |
| Physical State | Powder |
Ask Your Question
