Luisol A
Request a quote| Catalog Number | ACM225110598 |
| CAS | 225110-59-8 |
| Structure | ![{[CurrentData.Name]}](https://resource.alfa-chemistry.com/structure/225110-59-8.gif) |
| Description | Luisol A, an aromatic tetraol, is a major metabolite of an estuarine marine actinomycete of the genus Streptomyces. |
| IUPAC Name | (1S,2R,9S,10R,11S,13R)-2,7,9,10-Tetrahydroxy-11-methyl-12,16-dioxatetracyclo[11.3.1.01,10.03,8]heptadeca-3(8),4,6-trien-15-one |
| Synonyms | rel-(-)-(4R,6S,6aR,7S,12R,12aS)-3,4,6,6a,7,12-Hexahydro-6a,7,8,12-tetrahydroxy-6-methyl-4,12a-methano-2H,12aH-naphtho[2,3-b]-1,5-dioxocin-2-one |
| Molecular Weight | 322.31 |
| Molecular Formula | C16H18O7 |
| Canonical SMILES | CC1C2(C(C3=C(C=CC=C3O)C(C24CC(O1)CC(=O)O4)O)O)O |
| Inchi | InChI=1S/C16H18O7/c1-7-16(21)14(20)12-9(3-2-4-10(12)17)13(19)15(16)6-8(22-7)5-11(18)23-15/h2-4,7-8,13-14,17,19-21H,5-6H2,1H3/t7-,8-,13+,14-,15-,16-/m0/s1 |
| InChIKey | YAYLZJMYAWCSFK-MAHXAKIKSA-N |
| Purity | 95%+ |
| Physical State | Powder |
Ask Your Question
