Larixyl Acetate
Request a quote| Catalog Number | ACM4608495 |
| CAS | 4608-49-5 |
| Structure | ![{[CurrentData.Name]}](https://resource.alfa-chemistry.com/structure/4608-49-5.gif) |
| Description | Larixyl acetate is a potent and selective TRPC6 inhibitor with IC50 values of 0.58 μM and 6.83 μM against hTRPC6-YFP and hTRPC3-YFP, respectively. Larixyl acetate prevents HPV and is effective in protecting against traumatic brain injury-induced systemic endothelial dysfunction. |
| Synonyms | (Αs,1S,4S,4As,8Ar)-4-(Acetyloxy)-Α-Ethenyldecahydro-Α,5,5,8A-Tetramethyl-2-Methylene-1-Naphthalenepropanol |
| Molecular Weight | 348.52 |
| Molecular Formula | C22H36O3 |
| Canonical SMILES | CC(=O)OC1CC(=C)C([C@]2(C1C(CCC2)(C)C)C)CCC(C)(C=C)OC(=O)C |
| Purity | 96.21% |
Ask Your Question
