Kinsenoside
Request a quote| Catalog Number | ACM151870745 |
| CAS | 151870-74-5 |
| Description | Kinsenoside is a main active component isolated from plants of the genus Anoectochilus, and exhibits many biological activities and pharmacological effects. Kinsenoside rescues the nucleus pulposus cells (NPCs) viability under oxidative stress and protects against apoptosis, senescence and mitochondrial dysfunction in a Nrf2-dependent way. |
| IUPAC Name | (4R)-4-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoxolan-2-one |
| Synonyms | (4R)-4-(beta-D-Glucopyranosyloxy)dihydro-2(3H)-furanone |
| Molecular Weight | 264.23 |
| Molecular Formula | C10H16O8 |
| Canonical SMILES | C1[C@H](COC1=O)O[C@H]2[C@@H]([C@H]([C@@H]([C@H](O2)CO)O)O)O |
| Inchi | InChI=1S/C10H16O8/c11-2-5-7(13)8(14)9(15)10(18-5)17-4-1-6(12)16-3-4/h4-5,7-11,13-15H,1-3H2/t4-,5-,7-,8+,9-,10-/m1/s1 |
| InChIKey | MQEPWBMWFIVRPS-ZGSHZZHUSA-N |
| Purity | 95% |
| Density | 1.59±0.1 g/ml |
| Appearance | Solid |
| Storage | 4°C, protect from light*In solvent : -80°C, 6 months; -20°C, 1 month (protect from light). |
Ask Your Question
