Isobutyl salicylate
Request a quote| Catalog Number | ACM87194 |
| Product Name | Isobutyl salicylate |
| CAS Number | 87-19-4 |
| Structure |  |
| Description | Isobutyl salicylate is used as a reactant in the new boron(III)-catalyzed esterifications and amidations of carboxylic acids and Ritter addition reaction. |
| IUPAC Name | 2-Methylpropyl 2-hydroxybenzoate |
| Synonyms | Salicylic acid isobutyl |
| Molecular Weight | 194.23 |
| Molecular Formula | C11H14O3 |
| Canonical SMILES | CC(C)COC(=O)C1=CC=CC=C1O |
| Inchi | InChI=1S/C11H14O3/c1-8(2)7-14-11(13)9-5-3-4-6-10(9)12/h3-6,8,12H,7H2,1-2H3 |
| InChIKey | PTXDBYSCVQQBNF-UHFFFAOYSA-N |
| Boiling Point | 267 °C |
| Melting Point | 5.9 °C |
| Flash Point | 230 °F |
| Purity | 95%+ |
| Density | 1.064 g/mL at 25 °C(lit.) |
| Solubility | Insoluble in water, glycerol; soluble in organic solvents, oils |
| Appearance | Colorless to pale yellow clear liquid (est) |
| Physical State | Liquid |
| Refractive Index | n20/D 1.509(lit.) |
Ask Your Question
