Isobutyl isovalerate
Request a quote| Catalog Number | ACM589593 |
| Product Name | Isobutyl isovalerate |
| CAS Number | 589-59-3 |
| Structure |  |
| Description | 2-Methylpropyl-3-methylbutyrate has an aroma reminiscent of apple and raspberry. |
| IUPAC Name | 2-Methylpropyl 3-methylbutanoate |
| Synonyms | 2-Methylpropyl isovalerate |
| Molecular Weight | 158.24 |
| Molecular Formula | C9H18O2 |
| Canonical SMILES | CC(C)CC(=O)OCC(C)C |
| Inchi | InChI=1S/C9H18O2/c1-7(2)5-9(10)11-6-8(3)4/h7-8H,5-6H2,1-4H3 |
| InChIKey | KEBDNKNVCHQIJU-UHFFFAOYSA-N |
| Boiling Point | 168 °C |
| Melting Point | -92.8 °C |
| Flash Point | 57 °C |
| Purity | 98%+ |
| Density | 0.853 g/mL at 20 °C(lit.) |
| Solubility | Miscible with alcohol |
| Appearance | Colorless to pale yellow clear liquid (est) |
| Physical State | Liquid |
| Refractive Index | n20/D 1.406(lit.) |
Ask Your Question
