Isobutyl butyrate
Request a quote| Catalog Number | ACM539902 |
| CAS | 539-90-2 |
| Structure | ![{[CurrentData.Name]}](https://resource.alfa-chemistry.com/structure/539-90-2.gif) |
| Description | Isobutyl butyrate is a metabolite of Rifampicin, a Rifamycin antibiotic. |
| IUPAC Name | 2-Methylpropyl butanoate |
| Synonyms | Butanoic acid, isobutyl ester |
| Molecular Weight | 144.21 |
| Molecular Formula | C8H16O2 |
| Canonical SMILES | CCCC(=O)OCC(C)C |
| Inchi | InChI=1S/C8H16O2/c1-4-5-8(9)10-6-7(2)3/h7H,4-6H2,1-3H3 |
| InChIKey | RGFNRWTWDWVHDD-UHFFFAOYSA-N |
| Boiling Point | 157-158 °C |
| Melting Point | -88.07 °C |
| Flash Point | 114 °F |
| Purity | 99% |
| Density | 0.861 g/mL at 25 °C(lit.) |
| Solubility | Soluble in most fixed oils; slightly soluble in water; insoluble in glycerol |
| Appearance | Colorless to pale yellow liquid with banana-pineapple-pear sweet odor |
| Physical State | Liquid |
| Refractive Index | n20/D 1.403(lit.) |
Ask Your Question
