Isoamyl caproate
Request a quote| Catalog Number | ACM2198610 |
| Product Name | Isoamyl caproate |
| CAS Number | 2198-61-0 |
| Structure |  |
| IUPAC Name | 3-Methylbutyl hexanoate |
| Synonyms | Isopentyl hexanoate |
| Molecular Weight | 186.29 |
| Molecular Formula | C11H22O2 |
| Canonical SMILES | CCCCCC(=O)OCCC(C)C |
| Inchi | InChI=1S/C11H22O2/c1-4-5-6-7-11(12)13-9-8-10(2)3/h10H,4-9H2,1-3H3 |
| InChIKey | XVSZRAWFCDHCBP-UHFFFAOYSA-N |
| Boiling Point | 222 °C |
| Melting Point | -47 °C |
| Flash Point | 185 °F |
| Purity | 98%+ |
| Density | 0.86 g/mL at 25 °C(lit.) |
| Solubility | Soluble in ethanol and fixed oils, insoluble in glycerol, propylene glycol and water |
| Physical State | Liquid |
| Refractive Index | n20/D 1.42(lit.) |
Ask Your Question
