What is the molecular formula of Hypocrellin B?

The molecular formula of Hypocrellin B is C30H24O9.

What is the CAS number of Hypocrellin B?

The CAS number of Hypocrellin B is 123940-54-5.

The purity of Hypocrellin B is 98%.

The synonyms for Hypocrellin B are 1H-Cyclohepta(ghi)perylene-5,12-dione, 3-acetyl-6,11-dihydroxy-4,8,9,13-tetramethoxy-2-methyl-.

The molecular weight of Hypocrellin B is 528.51.

The physical state of Hypocrellin B is solid.

Hypocrellin B is used as an antioxidant and as a photosensitizing agent.

95% of Hypocrellin B is considered as actives.

Hypocrellin B can help prevent oxidative damage in cells and tissues.

Hypocrellin B can be used in photodynamic therapy to selectively destroy cancer cells when activated by light.

Name: Hypocrellin B
SKU: ACM123940545
Rating: 5 (1 reviews)

Catalog Number	ACM123940545
CAS	123940-54-5
Structure
Description	Hypocrellin B, a pigment isolated from the fungi Hypocrella bambusae and Shiraia bambusicola, is an apoptosis inducer. Hypocrellin B can be used as a photosensitizer for photodynamic therapy of cancer. Hypocrellin B also has antimicrobial and antileishmanial activities.
IUPAC Name	12-Acetyl-9,17-dihydroxy-5,10,16,21-tetramethoxy-13-methylhexacyclo[13.8.0.02,11.03,8.04,22.018,23]tricosa-1(15),2(11),3(8),4(22),5,9,12,16,18(23),20-decaene-7,19-dione
Synonyms	HC-B
Molecular Weight	528.51
Molecular Formula	C30H24O9
Canonical SMILES	CC1=C(C2=C3C4=C(C1)C(=C(C5=C4C(=C6C3=C(C(=O)C=C6OC)C(=C2OC)O)C(=CC5=O)OC)O)OC)C(=O)C
Inchi	InChI=1S/C30H24O9/c1-10-7-12-18-23-19(27(34)29(12)38-5)13(32)8-15(36-3)21(23)22-16(37-4)9-14(33)20-25(22)24(18)26(17(10)11(2)31)30(39-6)28(20)35/h8-9,34-35H,7H2,1-6H3
InChIKey	SBMXTMAIKRQSQE-UHFFFAOYSA-N
Boiling Point	893.8±65.0 °C
Melting Point	261-263 °C
Purity	98%
Density	1.52±0.1 g/ml
Appearance	Powder
Physical State	Solid