Hyperoside
Request a quote| Catalog Number | ACM482360 |
| CAS | 482-36-0 |
| Structure | ![{[CurrentData.Name]}](https://resource.alfa-chemistry.com/structure/482-36-0.gif) |
| Description | Hyperoside is a NF-κB inhibitor, found from Hypericum monogynum. Hyperoside shows anti-tumor, antifungal, anti-inflammatory, anti-viral, and anti-oxidative activities, and can induceapoptosis. |
| Molecular Weight | 464.38 |
| Molecular Formula | C21H20O12 |
| Canonical SMILES | OC1=CC(O)=C(C(C(O[C@H]2[C@H](O)[C@@H](O)[C@@H](O)[C@@H](CO)O2)=C(C3=CC=C(O)C(O)=C3)O4)=O)C4=C1 |
| Purity | 99.56% |
| Appearance | Solid |
| Storage | Powder-20°C, 3 years; 4°C, 2 years; In solvent-80°C, 6 months; -20°C, 1 month. |
Ask Your Question
