2-Hydroxychalcone
Request a quote| Catalog Number | ACM644780-1 |
| CAS | 644-78-0 |
| Structure | ![{[CurrentData.Name]}](https://resource.alfa-chemistry.com/structure/644-78-0.gif) |
| Description | 2-hydroxychalcone, a natural flavonoid, is a potent antioxidant, inhibiting lipid peroxidation. 2-Hydroxychalcone induces apoptosis by Bcl-2 downregulation. 2-Hydroxychalcone inhibits the activation of NF-kB. |
| IUPAC Name | (E)-3-(2-hydroxyphenyl)-1-phenylprop-2-en-1-one |
| Molecular Weight | 224.25 |
| Molecular Formula | C15H12O2 |
| Canonical SMILES | C1=CC=C(C=C1)C(=O)C=CC2=CC=CC=C2O |
| Inchi | InChI=1S/C15H12O2/c16-14-9-5-4-8-13(14)10-11-15(17)12-6-2-1-3-7-12/h1-11,16H/b11-10+ |
| InChIKey | UDOOPSJCRMKSGL-ZHACJKMWSA-N |
| Purity | 98.8% |
| Appearance | Solid |
| Storage | 4°C, sealed storage, away from moisture and light*In solvent : -80°C, 6 months; -20°C, 1 month (sealed storage, away from moisture and light) |
Ask Your Question
