Honokiol
Request a quote| Catalog Number | ACM35354746 |
| CAS | 35354-74-6 |
| Structure | ![{[CurrentData.Name]}](https://resource.alfa-chemistry.com/structure/35354-74-6.gif) |
| Description | Honokiol is a bioactive, biphenolic phytochemical that possesses potent antioxidative, anti-inflammatory, antiangiogenic, and anticancer activities by targeting a variety of signaling molecules. It inhibits the activation of Akt. Honokiol can readily cross the blood brain barrier. |
| IUPAC Name | 2-(4-Hydroxy-3-prop-2-enylphenyl)-4-prop-2-enylphenol |
| Synonyms | 3',5-Diallyl-2,4'-biphenyldiol |
| Molecular Weight | 266.33 |
| Molecular Formula | C18H18O2 |
| Canonical SMILES | C=CCC1=CC(=C(C=C1)O)C2=CC(=C(C=C2)O)CC=C |
| Inchi | InChI=1S/C18H18O2/c1-3-5-13-7-9-18(20)16(11-13)14-8-10-17(19)15(12-14)6-4-2/h3-4,7-12,19-20H,1-2,5-6H2 |
| InChIKey | FVYXIJYOAGAUQK-UHFFFAOYSA-N |
| Boiling Point | 400.1±40.0 °C |
| Melting Point | 86 °C |
| Flash Point | 184°C |
| Purity | 98% |
| Density | 1.107±0.06 g/ml |
| Appearance | White powder |
| Physical State | Solid |
| Refractive Index | 1.6 |
Ask Your Question
