What is the molecular formula of Homoplantaginin?

The molecular formula of Homoplantaginin is C22H22O11.

What is the molecular weight of Homoplantaginin?

The molecular weight of Homoplantaginin is 462.4 g/mol.

What is the IUPAC name of Homoplantaginin?

The IUPAC name of Homoplantaginin is 5-hydroxy-2-(4-hydroxyphenyl)-6-methoxy-7-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxychromen-4-one.

What is the InChI of Homoplantaginin?

The InChI of Homoplantaginin is InChI=1S/C22H22O11/c1-30-21-14(32-22-20(29)19(28)17(26)15(8-23)33-22)7-13-16(18(21)27)11(25)6-12(31-13)9-2-4-10(24)5-3-9/h2-7,15,17,19-20,22-24,26-29H,8H2,1H3/t15-,17-,19+,20-,22-/m1/s1.

What is the molecular structure of Homoplantaginin?

The molecular structure of Homoplantaginin can be viewed using this link: https://pubchem.ncbi.nlm.nih.gov/image/imgsrv.fcgi?cid=5318083&t=l.

What is the CAS number of Homoplantaginin?

The CAS number of Homoplantaginin is 17680-84-1.

Is Homoplantaginin a natural product?

Yes, Homoplantaginin is a natural product found in Scoparia dulcis, Eriocaulon buergerianum, and other organisms.

How many hydrogen bond donor counts does Homoplantaginin have?

Homoplantaginin has 6 hydrogen bond donor counts.

How many hydrogen bond acceptor counts does Homoplantaginin have?

Homoplantaginin has 11 hydrogen bond acceptor counts.

What is the topological polar surface area of Homoplantaginin?

The topological polar surface area of Homoplantaginin is 175Å².

CAS 17680-84-1 Homoplantaginin - Carboxyl / Alfa Chemistry

Name: Homoplantaginin
SKU: ACM17680841
Rating: 5 (1 reviews)

Catalog Number	ACM17680841
CAS	17680-84-1
Structure
Description	Homoplantaginin is a flavonoid from a traditional Chinese medicine Salvia plebeia with antiinflammatory and antioxidant properties. Homoplantaginin could inhibit TNF-α and IL-6 mRNA expression, IKKβ and NF-κB phosphorylation.
IUPAC Name	5-hydroxy-2-(4-hydroxyphenyl)-6-methoxy-7-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxychromen-4-one
Synonyms	HOMOPLANTAGININ;7-(beta-D-Glucopyranosyloxy)-5-hydroxy-2-(4-hydroxyphenyl)-6-methoxy-4H-1-Benzopyran-4-one;Hispidulin 7-glucoside;Hispiduloside;4H-1-Benzopyran-4-one,7-(b-D-glucopyranosyloxy)-5-hydroxy-2-(4-hydroxyphenyl)-6-methoxy-
Molecular Weight	462.40
Molecular Formula	C22H22O11
Canonical SMILES	COC1=C(C=C2C(=C1O)C(=O)C=C(O2)C3=CC=C(C=C3)O)OC4C(C(C(C(O4)CO)O)O)O
InChIKey	GCLAFEGUXXHIFT-IWLDQSELSA-N
Boiling Point	798.1ºC at 760 mmHg
Melting Point	256-258°C
Flash Point	279.7ºC
Purity	96%
Density	1.609
Appearance	white crystalline