Hibifolin
Request a quote| Catalog Number | ACM55366568 |
| CAS | 55366-56-8 |
| Description | Hibifolin is a flavonol glycoside that prevents beta-amyloid-induced neurotoxicity in vitro. Hibifolin prevents beta-amyloid-induced neurotoxicity in cultured cortical neurons. Hibifolin is a potential inhibitor of adenosine deaminase. |
| IUPAC Name | beta-D-Glucopyranosiduronic acid, 2-(3,4-dihydroxyphenyl)-3,5,7-trihydroxy-4-oxo-4H-1-benzopyran-8-yl |
| Synonyms | Hibifolin; Gossypetin 8-O-beta-D-glucuronide |
| Molecular Weight | 494.36 |
| Molecular Formula | C21H18O14 |
| Canonical SMILES | O[C@H]([C@H]([C@@H]([C@@H](C(O)=O)O1)O)O)[C@@H]1OC2=C3C(C(C(O)=C(C4=CC=C(O)C(O)=C4)O3)=O)=C(O)C=C2O |
| Inchi | InChI=1S/C21H18O14/c22-6-2-1-5(3-7(6)23)16-13(28)11(26)10-8(24)4-9(25)17(18(10)33-16)34-21-15(30)12(27)14(29)19(35-21)20(31)32/h1-4,12,14-15,19,21-25,27-30H,(H,31,32)/t12-,14-,15+,19-,21+/m0/s1 |
| InChIKey | KHVMAMXQPVHXTJ-ORYXKJSJSA-N |
| Purity | 99% |
| Solubility | Soluble in DMSO |
| Appearance | Solid powder |
| Shelf Life | >3 years if stored properly |
| Storage | Dry, dark and at 0-4 °C for short term (days to weeks) or -20 °C for long term (months to years). |
Ask Your Question
