Hecogenin
Request a quote| Catalog Number | ACM467550 |
| CAS | 467-55-0 |
| Structure | ![{[CurrentData.Name]}](https://resource.alfa-chemistry.com/structure/467-55-0.gif) |
| Description | Hecogenin is a steroid saponin isolated from Agave sisalana and is a selective inhibitor of human UDP-glucuronosyltransferases. Hecogenin has a wide spectrum of pharmacological activities, including anti-inflammatory, antifungal and gastroprotective effects. |
| Molecular Weight | 430.62 |
| Molecular Formula | C27H42O4 |
| Canonical SMILES | CC1CCC2(C(C3C(O2)CC4C3(C(=O)CC5C4CCC6C5(CCC(C6)O)C)C)C)OC1 |
| Inchi | InChI=1S/C27H42O4/c1-15-7-10-27(30-14-15)16(2)24-22(31-27)12-21-19-6-5-17-11-18(28)8-9-25(17,3)20(19)13-23(29)26(21,24)4/h15-22,24,28H,5-14H2,1-4H3/t15-,16+,17+,18+,19-,20+,21+,22+,24+,25+,26-,27-/m1/s1 |
| InChIKey | QOLRLLFJMZLYQJ-LOBDNJQFSA-N |
| Purity | 98% |
| Appearance | White powder |
| Storage | Powder-20°C, 3 years; 4°C, 2 years; In solvent-80°C, 6 months; -20°C, 1 month. |
Ask Your Question
