Genistein
Request a quote| Catalog Number | ACM446720 |
| CAS | 446-72-0 |
| Structure | ![{[CurrentData.Name]}](https://resource.alfa-chemistry.com/structure/446-72-0.gif) |
| Description | Having property of female hormone and antiestrogenic Having oxidation resistance effect Control activity of PTK Control activity of topoisomeraseII |
| IUPAC Name | 5,7-Dihydroxy-3-(4-hydroxyphenyl)chromen-4-one |
| Synonyms | Sophoricol |
| Molecular Weight | 270.24 |
| Molecular Formula | C15H10O5 |
| Canonical SMILES | C1=CC(=CC=C1C2=COC3=CC(=CC(=C3C2=O)O)O)O |
| Inchi | InChI=1S/C15H10O5/c16-9-3-1-8(2-4-9)11-7-20-13-6-10(17)5-12(18)14(13)15(11)19/h1-7,16-18H |
| InChIKey | TZBJGXHYKVUXJN-UHFFFAOYSA-N |
| Boiling Point | 333.35 °C |
| Melting Point | 297-298 °C |
| Flash Point | 217.1 °C |
| Purity | 98% |
| Density | 1.2319 g/cm³ |
| Solubility | Insoluble in water |
| Appearance | Off-white powder |
| Storage | -20 °C |
| Physical State | Solid |
| Refractive Index | 1.6000 |
Ask Your Question
