Fisetin
Request a quote| Catalog Number | ACM528483 |
| CAS | 528-48-3 |
| Structure | ![{[CurrentData.Name]}](https://resource.alfa-chemistry.com/structure/528-48-3.gif) |
| Description | Fisetin is a natural flavonol found in many fruits and vegetables with various benefits, such as antioxidant, anticancer, neuroprotection effects. |
| IUPAC Name | 2-(3,4-Dihydroxyphenyl)-3,7-dihydroxychromen-4-one |
| Synonyms | 3,7,3',4'-Tetrahydroxyflavone |
| Molecular Weight | 286.24 |
| Molecular Formula | C15H10O6 |
| Canonical SMILES | C1=CC(=C(C=C1C2=C(C(=O)C3=C(O2)C=C(C=C3)O)O)O)O |
| Inchi | InChI=1S/C15H10O6/c16-8-2-3-9-12(6-8)21-15(14(20)13(9)19)7-1-4-10(17)11(18)5-7/h1-6,16-18,20H |
| InChIKey | XHEFDIBZLJXQHF-UHFFFAOYSA-N |
| Boiling Point | 348.61 °C |
| Melting Point | >330 °C(lit.) |
| Flash Point | 233 °C |
| Purity | 97% |
| Density | 1.2981 g/cm³ |
| Solubility | Slightly soluble in DMSO, methanol |
| Appearance | Solid |
| Storage | Sealed in dry, store in freezer, under -20 °C |
| Refractive Index | 1.4413 |
Ask Your Question
