Enfumafungin
Request a quote| Catalog Number | ACM260979951 |
| CAS | 260979-95-1 |
| Description | Enfumafungin, a triterpene glycoside, is isolated from extracts derived from fungus Hormonema carpetanum. Enfumafungin is an antifungal compound that is acting on the fungal cell wall, as the (1,3)-beta-D-glucan synthase inhibitor. Enfumafungin is specific for yeasts and fungi (excluding Cryptococcus) and does not inhibit the growth of Bacillus subtilis. |
| Molecular Weight | 708.88 |
| Molecular Formula | C38H60O12 |
| Canonical SMILES | OC(OC1)[C@@]([C@](CC2)([H])[C@@]1([C@H]3O[C@]([C@@H]([C@H]4O)O)([H])O[C@@H]([C@H]4O)CO)C)(C[C@H]3OC(C)=O)C([C@@]2([H])[C@]5(CC[C@]6(C)[C@H](C)C(C)C)C)=CC[C@]5([C@@H]6C(O)=O)C |
| Purity | 98% |
| Appearance | Solid |
| Storage | Powder-20°C, 3 years; 4°C, 2 years; In solvent-80°C, 6 months; -20°C, 1 month. |
Ask Your Question
