Dehydrojuncusol
Request a quote| Catalog Number | ACM117824041 |
| CAS | 117824-04-1 |
| Structure | ![{[CurrentData.Name]}](https://resource.alfa-chemistry.com/structure/117824-04-1.gif) |
| Description | Dehydrojuncusol, a potent HCV inhibitor, targets HCV NS5A and is able to inhibit RNA replication of replicons harboring resistance mutations to anti-NS5A direct-acting antivirals. Dehydrojuncusol significantly inhibits HCV infection when added after virus inoculation of HCV genotype 2a (EC50=1.35 µM). |
| IUPAC Name | 5-ethenyl-1,6-dimethylphenanthrene-2,7-diol |
| Molecular Weight | 264.3 |
| Molecular Formula | C18H16O2 |
| Canonical SMILES | CC1=C(C=CC2=C1C=CC3=CC(=C(C(=C32)C=C)C)O)O |
| Inchi | InChI=1S/C18H16O2/c1-4-13-10(2)17(20)9-12-5-6-14-11(3)16(19)8-7-15(14)18(12)13/h4-9,19-20H,1H2,2-3H3 |
| InChIKey | IZVFYHBVHNNKGE-UHFFFAOYSA-N |
| Purity | 98% |
| Appearance | Powder |
| Storage | Please store the product under the recommended conditions in the Certificate of Analysis. |
Ask Your Question
