Daidzin
Request a quote| Catalog Number | ACM552669 |
| CAS | 552-66-9 |
| Structure | ![{[CurrentData.Name]}](https://resource.alfa-chemistry.com/structure/552-66-9.gif) |
| Description | Daidzin is an isoflavone that has anti-oxidant, anti-carcinogenic, and anti-atherosclerotic activities; directly inhibits mitochondrial aldehyde dehydrogenase 2 (IC50 = 80 nM) and is an effective anti-dipsotropic isoflavone. |
| Synonyms | Daidzoside |
| Molecular Weight | 416.38 |
| Molecular Formula | C21H20O9 |
| Canonical SMILES | OC1=CC=C(C2=COC(C=C(O[C@H]3[C@H](O)[C@@H](O)[C@H](O)[C@@H](CO)O3)C=C4)=C4C2=O)C=C1 |
| Melting Point | 234-236°C |
| Purity | 99.77% |
| Appearance | Solid |
| Storage | Powder-20°C, 3 years; 4°C, 2 years; In solvent-80°C, 6 months; -20°C, 1 month. |
Ask Your Question
