Chelidonic Acid
Request a quote| Catalog Number | ACM99321 |
| CAS | 99-32-1 |
| Structure | ![{[CurrentData.Name]}](https://resource.alfa-chemistry.com/structure/99-32-1.gif) |
| Description | Chelidonic acid is a component of Chelidonium majus L., used as an antimicrobial. Chelidonic acid also shows anti-inflammatory activity. Chelidonic acid has potential to inhibit IL-6 production by blocking NF-κB and caspase-1. Chelidonic acid is a glutamate decarboxylase inhibitor, with a Ki of 1.2 μM. |
| IUPAC Name | 4-oxopyran-2,6-dicarboxylic acid |
| Synonyms | 4-oxopyran-2,6-dicarboxylic acid; |
| Molecular Weight | 184.10 |
| Molecular Formula | C7H4O6 |
| Canonical SMILES | C1=C(OC(=CC1=O)C(=O)O)C(=O)O |
| InChIKey | PBAYDYUZOSNJGU-UHFFFAOYSA-N |
| Boiling Point | 471.3ºC at 760 mmHg |
| Melting Point | 265ºC (dec.) |
| Flash Point | 204.1ºC |
| Purity | 97% |
| Density | 1.821 g/cm³ |
Ask Your Question
