Carnosic Acid
Request a quote| Catalog Number | ACM3650097 |
| CAS | 3650-09-7 |
| Structure | ![{[CurrentData.Name]}](https://resource.alfa-chemistry.com/structure/3650-09-7.gif) |
| Description | Carnosic acid has demonstrated inhibition of oxidative stress and inflammation, suppression of cell proliferation, and antibacterial activity. |
| IUPAC Name | (4aR,10aS)-5,6-dihydroxy-1,1-dimethyl-7-propan-2-yl-2,3,4,9,10,10a-hexahydrophenanthrene-4a-carboxylic acid |
| Synonyms | Carnosic acid from Rosmarinus officinalis |
| Molecular Weight | 332.43 |
| Molecular Formula | C20H28O4 |
| Canonical SMILES | CC(C)C1=C(C(=C2C(=C1)CC[C@@H]3[C@@]2(CCCC3(C)C)C(=O)O)O)O |
| Inchi | InChI=1S/C20H28O4/c1-11(2)13-10-12-6-7-14-19(3,4)8-5-9-20(14,18(23)24)15(12)17(22)16(13)21/h10-11,14,21-22H,5-9H2,1-4H3,(H,23,24)/t14-,20+/m0/s1 |
| InChIKey | QRYRORQUOLYVBU-VBKZILBWSA-N |
| Boiling Point | 506.4±50.0 °C |
| Melting Point | 190 °C (lit.) |
| Purity | 98% |
| Density | 1.184±0.06 g/ml |
| Appearance | Yellow powder |
| Storage | -80°C, stored under nitrogen |
| Physical State | Powder |
Ask Your Question
