What is the molecular formula of betulinic acid?

The molecular formula of betulinic acid is C30H48O3.

What is the molecular weight of betulinic acid?

The molecular weight of betulinic acid is 456.7 g/mol.

What is the IUPAC name of betulinic acid?

The IUPAC name of betulinic acid is (1R,3aS,5aR,5bR,7aR,9S,11aR,11bR,13aR,13bR)-9-hydroxy-5a,5b,8,8,11a-pentamethyl-1-prop-1-en-2-yl-1,2,3,4,5,6,7,7a,9,10,11,11b,12,13,13a,13b-hexadecahydrocyclopenta[a]chrysene-3a-carboxylic acid.

What are the synonyms of betulinic acid?

The synonyms of betulinic acid include betulic acid, Mairin, and Lupatic Acid.

What is the CAS number of betulinic acid?

The CAS number of betulinic acid is 472-15-1.

What are the chemical properties of betulinic acid?

Betulinic acid is a pentacyclic triterpenoid with a double bond at position 20(29), as well as 3beta-hydroxy and 28-carboxy substituents. It is a hydroxy monocarboxylic acid derived from a hydride of a lupane.

What are the uses of betulinic acid?

Betulinic acid has been used in trials for the treatment of Dysplastic Nevus Syndrome. It exhibits anti-HIV, antimalarial, antineoplastic, and anti-inflammatory properties.

In which organisms is betulinic acid found?

Betulinic acid is found in the bark and other plant parts of several species of plants, including Syzygium claviflorum, Ficus auriculata, and Gladiolus italicus.

What are some computed properties of betulinic acid?

Some computed properties of betulinic acid include a molecular weight of 456.7 g/mol and an XLogP3-AA value of 8.2.

What is the InChIKey of betulinic acid?

The InChIKey of betulinic acid is QGJZLNKBHJESQX-FZFNOLFKSA-N.

CAS 472-15-1 Betulinic Acid - Carboxyl / Alfa Chemistry

Name: Betulinic Acid
SKU: ACM472151
Rating: 5 (1 reviews)

Catalog Number	ACM472151
CAS	472-15-1
Description	Betulinic acid is a natural pentacyclic triterpenoid, acts as a eukaryotic topoisomerase I inhibitor, with an IC50 of 5 μM, and possesses anti-HIV, anti-malarial, anti-inflammatory and anti-tumor properties.
IUPAC Name	(1R,3aS,5aR,5bR,7aR,9S,11aR,11bR,13aR,13bR)-9-Hydroxy-5a,5b,8,8,11a-pentamethyl-1-prop-1-en-2-yl-1,2,3,4,5,6,7,7a,9,10,11,11b,12,13,13a,13b-hexadecahydrocyclopenta[a]chrysene-3a-carboxylic acid
Synonyms	Mairin
Molecular Weight	456.71
Molecular Formula	C30H48O3
Canonical SMILES	CC(=C)C1CCC2(C1C3CCC4C5(CCC(C(C5CCC4(C3(CC2)C)C)(C)C)O)C)C(=O)O
Inchi	InChI=1S/C30H48O3/c1-18(2)19-10-15-30(25(32)33)17-16-28(6)20(24(19)30)8-9-22-27(5)13-12-23(31)26(3,4)21(27)11-14-29(22,28)7/h19-24,31H,1,8-17H2,2-7H3,(H,32,33)/t19-,20+,21-,22+,23-,24+,27-,28+,29+,30-/m0/s1
InChIKey	QGJZLNKBHJESQX-FZFNOLFKSA-N
Boiling Point	550.0±33.0 °C
Melting Point	295-298 °C(lit.)
Flash Point	300.5ºC
Purity	98%
Density	1.065±0.06 g/cm³
Appearance	Solid
Storage	2-8 °C