Benzyl isobutyrate
Request a quote| Catalog Number | ACM103286 |
| CAS | 103-28-6 |
| Structure | ![{[CurrentData.Name]}](https://resource.alfa-chemistry.com/structure/103-28-6.gif) |
| IUPAC Name | Benzyl 2-methylpropanoate |
| Synonyms | Phenylmethyl 2-methylpropanoate |
| Molecular Weight | 178.23 |
| Molecular Formula | C11H14O2 |
| Canonical SMILES | CC(C)C(=O)OCC1=CC=CC=C1 |
| Inchi | InChI=1S/C11H14O2/c1-9(2)11(12)13-8-10-6-4-3-5-7-10/h3-7,9H,8H2,1-2H3 |
| InChIKey | UIKJRDSCEYGECG-UHFFFAOYSA-N |
| Boiling Point | 238 °C |
| Flash Point | 138 °F |
| Purity | 98%+ |
| Density | 1.003 g/mL at 25 °C(lit.) |
| Solubility | Insoluble in water and glycerin, soluble in organic solvents, oils |
| Appearance | Colorless liquid with a fresh, fruity-floral odour |
| Physical State | Liquid |
| Refractive Index | n20/D 1.49(lit.) |
Ask Your Question
