Azobenzene-4,4'-dicarboxylic acid
Request a quote| Catalog Number | ACM586914 |
| CAS | 586-91-4 |
| Structure | ![{[CurrentData.Name]}](https://resource.alfa-chemistry.com/structure/586-91-4.gif) |
| IUPAC Name | 4-[(4-carboxyphenyl)diazenyl]benzoic acid |
| Synonyms | 2,4-Bis(1H-imidazol-1-yl)-6-hydroxy-1,3,5-triazine |
| Molecular Weight | 270.24 |
| Molecular Formula | C14H10N2O4 |
| Canonical SMILES | C1=CC(=CC=C1C(=O)O)N=NC2=CC=C(C=C2)C(=O)O |
| Inchi | InChI=1S/C14H10N2O4/c17-13(18)9-1-5-11(6-2-9)15-16-12-7-3-10(4-8-12)14(19)20/h1-8H,(H,17,18)(H,19,20) |
| InChIKey | NWHZQELJCLSKNV-UHFFFAOYSA-N |
| Boiling Point | 541.2±35.0 °C(Predicted) |
| Melting Point | 344 °C(dec.) |
| Purity | 98% |
| Density | 1.35±0.1 g/cm3(Predicted) |
| Appearance | Light yellow to Brown powder to crystal |
| Storage | Store under inert gas |
| Physical State | Yellow solid |
Ask Your Question
