Arteannuin B
Request a quote| Catalog Number | ACM50906564 |
| CAS | 50906-56-4 |
| Description | Arteannuin B co-occurs with artemisinin, which is the potent antimalarial principle of the Chinese medicinal herb Artemisia annua (Asteraceae). Arteannuin B shows anti-SARS-CoV-2 potential with an EC50 of 10.28 μM. |
| Molecular Weight | 248.3 |
| Molecular Formula | C15H20O3 |
| Canonical SMILES | CC1CCC2C(=C)C(=O)OC23C1CCC4(C3O4)C |
| InChIKey | QWQSMEDUZQDVLA-USPGQWGOSA-N |
| Purity | 98% |
| Appearance | Powder |
| Storage | 4°C, protect from light*In solvent : -80°C, 6 months; -20°C, 1 month (protect from light). |
Ask Your Question
