Alternariol
Request a quote| Catalog Number | ACM641383-1 |
| CAS | 641-38-3 |
| Structure | ![{[CurrentData.Name]}](https://resource.alfa-chemistry.com/structure/641-38-3.gif) |
| Description | Alternariol is a mycotoxin produced by Alternaria species. AOH inhibits the catalytic activity of topoisomerase I andtopoisomerase II enzymes. Alternariol exhibits a variety of therapeutic and biological properties such as phytotoxicity, cytotoxicity, anti-HIV, anti-cancer, and anti-microbial properties. |
| IUPAC Name | 3,7,9-trihydroxy-1-methylbenzo[c]chromen-6-one |
| Molecular Weight | 258.22 |
| Molecular Formula | C14H10O5 |
| Canonical SMILES | CC1=CC(=CC2=C1C3=CC(=CC(=C3C(=O)O2)O)O)O |
| Inchi | InChI=1S/C14H10O5/c1-6-2-7(15)5-11-12(6)9-3-8(16)4-10(17)13(9)14(18)19-11/h2-5,15-17H,1H3 |
| InChIKey | CEBXXEKPIIDJHL-UHFFFAOYSA-N |
| Purity | 98% |
| Appearance | Powder |
| Storage | 4°C, protect from light*In solvent : -80°C, 6 months; -20°C, 1 month (protect from light). |
Ask Your Question
