9,10-Anthracenedicarboxylic acid
Request a quote| Catalog Number | ACM73016087-1 |
| CAS | 73016-08-7 |
| Description | 9,10-Anthracenedicarboxylic acid (H2L) is an anthracene based dicarboxylic compound, which has a larger conjugating π-system that enables the development of fluorescent materials. It has interesting magnetic and luminescent properties. It can be used as a bridging carboxylic acid ligand with a steric bulk due to the presence of its anthracene ring. |
| IUPAC Name | anthracene-9,10-dicarboxylic acid |
| Synonyms | H2ADC |
| Molecular Weight | 266.25 |
| Molecular Formula | C16H10O4 |
| Canonical SMILES | C1=CC=C2C(=C1)C(=C3C=CC=CC3=C2C(=O)O)C(=O)O |
| Inchi | 1S/C16H10O4/c17-15(18)13-9-5-1-2-6-10(9)14(16(19)20)12-8-4-3-7-11(12)13/h1-8H,(H,17,18)(H,19,20) |
| InChIKey | FDFGHPKPHFUHBP-UHFFFAOYSA-N |
| Boiling Point | >300 °C |
| Melting Point | >300 °C |
| Flash Point | Not applicable |
| Purity | 96% |
| Appearance | Yellow solid |
| Physical State | Yellow solid |
Ask Your Question
