5-Hydroxyisophthalic Acid
Request a quote| Catalog Number | ACM618837 |
| CAS | 618-83-7 |
| Structure | ![{[CurrentData.Name]}](https://resource.alfa-chemistry.com/structure/618-83-7.gif) |
| IUPAC Name | 5-hydroxybenzene-1,3-dicarboxylic acid |
| Molecular Weight | 182.13 |
| Molecular Formula | C8H6O5 |
| Canonical SMILES | C1=C(C=C(C=C1C(=O)O)O)C(=O)O |
| Inchi | InChI=1S/C8H6O5/c9-6-2-4(7(10)11)1-5(3-6)8(12)13/h1-3,9H,(H,10,11)(H,12,13) |
| InChIKey | QNVNLUSHGRBCLO-UHFFFAOYSA-N |
| Boiling Point | 516.9 °C at 760 mmHg |
| Melting Point | 359 °C |
| Purity | 98% |
| Density | 1.3293 (rough estimate) |
| Appearance | White to Almost white powder to crystal |
| Storage | Store under inert gas |
| Refractive Index | 1.4330 (estimate) |
Ask Your Question
