4-Hydroxybenzoic Acid
Request a quote| Catalog Number | ACM99967 |
| CAS | 99-96-7 |
| Structure | ![{[CurrentData.Name]}](https://resource.alfa-chemistry.com/structure/99-96-7.gif) |
| Description | PelletsLargeCrystals;Solid;Solid;White crystalline powder; faint nutty odour |
| IUPAC Name | 4-Hydroxybenzoic acid |
| Synonyms | p-Hydroxybenzoic |
| Molecular Weight | 138.12 |
| Molecular Formula | C7H6O3 |
| Canonical SMILES | C1=CC(=CC=C1C(=O)O)O |
| Inchi | InChI=1S/C7H6O3/c8-6-3-1-5(2-4-6)7(9)10/h1-4,8H,(H,9,10) |
| InChIKey | FJKROLUGYXJWQN-UHFFFAOYSA-N |
| Melting Point | 213-217 °C (lit.) |
| Flash Point | 199°C |
| Purity | 98% |
| Density | 1.46 g/ml |
| Solubility | 0.04 M;5 mg/mL at 25 °C;Solubility (in 100 g of solution): 99% ethanol 38.75 g (67 °C); n-butanol 19.5 g (32.5 °C);Soluble in about 125 parts water, freely in alcohol, slightly in chloroform; soluble in ether, acetone. Practically insoluble in carbon disulfide.;In water, 5000 mg/L at 25 °C;5.0 mg/mL;slightly soluble in water; soluble in organic solvents;freely soluble (in ethanol) |
| Appearance | Solid |
| Application | 4-Hydroxybenzoic Acid, also known as PHBA, serves multiple purposes across various industries due to its unique chemical properties. Primarily, it functions as a crucial intermediate in the synthesis of dyes, antiseptics, and active pharmaceutical ingredients. The acid's esters, commonly referred to as parabens, are extensively employed as preservatives in cosmetics and certain ophthalmic solutions. Moreover, it is applied as a food preservative, corrosion inhibitor, antioxidant, and emulsifier. In the realm of materials science, 4-hydroxybenzoic acid is integral to the creation of Vectran fiber through its reaction with 6-hydroxynaphthalene-2-carboxylic acid, resulting in an aromatic polyester. It is also a precursor in manufacturing compounds such as p-hydroxyphenylbenzoate, p-acetoxybenzoyl chloride, and 4,4'-dihydroxybenzophenone. Additionally, it finds applications in paint and coating additives, processing aids, and various electrical and electronic products. Through its diverse uses, 4-hydroxybenzoic acid plays a significant role in enhancing the functionality and longevity of numerous products. |
| Physical State | Solid |
| Refractive Index | 1.53 |
Ask Your Question
