4-Ethylbenzaldehyde
Request a quote| Catalog Number | ACM4748781 |
| CAS | 4748-78-1 |
| Structure | ![{[CurrentData.Name]}](https://resource.alfa-chemistry.com/structure/4748-78-1.gif) |
| Description | 2-Bromo-9,9-dimethylfluorene is a fluorene derivative which shows π-electron conjugation. It has a high fluorescent and high electron delocalization. It can be used as a non-linear optical (NLO) material. 2-bromo-9, 9-diphenylfluorene can be synthesized by using 2-bromofluorene and iodomethane as the major reactants. It can be majorly used in organic electronic based applications. |
| IUPAC Name | 4-ethylbenzaldehyde |
| Synonyms | p-Ethylbenzaldehyde, Benzaldehyde, 4-ethyl-, Ethyl benzaldehyde, Benzaldehyde, ethyl-, 4-ETHYLBENZALDEHYDE, Ethylbenzaldehyde, p-, ETHYLBENZALDEHYDE, Benzaldehyde, P-ethyl-, BENZALDEHYDE,4-ETHYL, W375608_ALDRICH, FEMA No. 3756, 233633_ALDRICH, EINECS 225-268-8, ZINC02003388, ST5213337, 4748-78-1, InChI=1/C9H10O/c1-2-8-3-5-9(7-10)6-4-8/h3-7H,2H2,1H, 53951-50-1 |
| Molecular Weight | 134.18 |
| Molecular Formula | C9H10O |
| InChIKey | QNGNSVIICDLXHT-UHFFFAOYSA-N |
| Boiling Point | 221ºC |
| Flash Point | 92°C |
| Purity | 98% |
| Density | 0.979 |
| Appearance | Colourless to pale yellow liquid with a sweet, bitter-almond odour |
| Refractive Index | 1.537-1.541 |
Ask Your Question
